Product Introduction
| Molecular Weight | 964.31 |
| NACRES | NA.22 |
| PubChem Substance ID | 329767900 |
| Form | Solid |
| Reaction Suitability | Reaction type: click chemistry |
| Smiles String | CC1(C)C(/C=C/C=C2N(CCCS([O-])(=O)=O)C3=CC=C(S(=O)([O-])=O)C=C3C/2(C)C)=[N+](CCCCCC(NCC#C)=O)C4=C1C=C(S(=O)([O-])=O)C=C4.CC[NH+](CC)CC.CC[NH+](CC)CC |
| InChI | 1S/C35H43N3O10S3.2C6H15N/c1-6-19-36-33(39)14-8-7-9-20-37-29-17-15-25(50(43,44)45)23-27(29)34(2,3)31(37)12-10-13-32-35(4,5)28-24-26(51(46,47)48)16-18-30(28)38(32)21-11-22-49(40,41)42;2*1-4-7(5-2)6-3/h1,10,12-13,15-18,23-24H,7-9,11,14,19-22H2,2-5H3,(H3-,36,39,40,41,42,43,44,45,46,47,48);2*4-6H2,1-3H3 |
| InChI key | OZKAPYXVMSRMDQ-UHFFFAOYSA-N |
| Storage Temp. | -20 °C |
Application
Alkyne modified cyanine dye. Can be used to detect or label azide-containing molecules or biomolecules by fluorescence spectroscopy following azide-alkyne cycloaddition.Solubility: DMSO, water, DMF, MeOHAbs/Em: 553/566 nmExtinction Coefficient: 151,000 cm-1M-1
Safety Information
| Signal Word | Warning |
| Target Organs | Respiratory system |
| Hazard Classifications | H315 - H319 - H335 |
| Storage Class Code | 11 - Combustible Solids |
| WGK | WGK 3 |
For research use only. Not for clinical use.